C10H13ClO — CID 15455933
(5E,7E,9E)-10-chlorodeca-5,7,9-trien-4-one (PubChem CID 15455933) has the molecular formula C10H13ClO and a molecular weight of 184.67 g/mol. Its IUPAC name is (5E,7E,9E)-10-chlorodeca-5,7,9-trien-4-one.
| Compound Name | (5E,7E,9E)-10-chlorodeca-5,7,9-trien-4-one |
|---|---|
| PubChem CID | 15455933 |
| Molecular Formula | C10H13ClO |
| Molecular Weight | 184.67 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (5E,7E,9E)-10-chlorodeca-5,7,9-trien-4-one |
| SMILES | CCCC(=O)/C=C/C=C/C=C/Cl |
| InChI | InChI=1S/C10H13ClO/c1-2-7-10(12)8-5-3-4-6-9-11/h3-6,8-9H,2,7H2,1H3/b4-3+,8-5+,9-6+ |
| InChIKey | YHCQSWDJDCQMIV-RNGLNSBOSA-N |
| XLogP | 3.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.67 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|