C9H12Cl2 — CID 142010123
(2E,4Z,6E)-3-chloro-6-(chloromethylidene)octa-2,4-diene (PubChem CID 142010123) has the molecular formula C9H12Cl2 and a molecular weight of 191.10 g/mol. Its IUPAC name is (2E,4Z,6E)-3-chloro-6-(chloromethylidene)octa-2,4-diene.
| Compound Name | (2E,4Z,6E)-3-chloro-6-(chloromethylidene)octa-2,4-diene |
|---|---|
| PubChem CID | 142010123 |
| Molecular Formula | C9H12Cl2 |
| Molecular Weight | 191.10 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | (2E,4Z,6E)-3-chloro-6-(chloromethylidene)octa-2,4-diene |
| SMILES | C/C=C(Cl)\C=C/C(=C/Cl)CC |
| InChI | InChI=1S/C9H12Cl2/c1-3-8(7-10)5-6-9(11)4-2/h4-7H,3H2,1-2H3/b6-5-,8-7+,9-4+ |
| InChIKey | XOSJDUQNMGBFRB-ARJLVYNQSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.10 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|