C10H15ClN2O — CID 153341495
[(3Z,5Z,7E)-7-chloronona-3,5,7-trien-4-yl]urea (PubChem CID 153341495) has the molecular formula C10H15ClN2O and a molecular weight of 214.70 g/mol. Its IUPAC name is [(3Z,5Z,7E)-7-chloronona-3,5,7-trien-4-yl]urea.
| Compound Name | [(3Z,5Z,7E)-7-chloronona-3,5,7-trien-4-yl]urea |
|---|---|
| PubChem CID | 153341495 |
| Molecular Formula | C10H15ClN2O |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | [(3Z,5Z,7E)-7-chloronona-3,5,7-trien-4-yl]urea |
| SMILES | C/C=C(Cl)\C=C/C(=C/CC)NC(N)=O |
| InChI | InChI=1S/C10H15ClN2O/c1-3-5-9(13-10(12)14)7-6-8(11)4-2/h4-7H,3H2,1-2H3,(H3,12,13,14)/b7-6-,8-4+,9-5- |
| InChIKey | JZNROXQYDIMKKE-ZEELDGCASA-N |
| XLogP | 2.65 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|