C10H15NO — CID 89285655
(2E,4E)-4-[(Z)-prop-1-enyl]hepta-2,4-dienamide (PubChem CID 89285655) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (2E,4E)-4-[(Z)-prop-1-enyl]hepta-2,4-dienamide.
| Compound Name | (2E,4E)-4-[(Z)-prop-1-enyl]hepta-2,4-dienamide |
|---|---|
| PubChem CID | 89285655 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (2E,4E)-4-[(Z)-prop-1-enyl]hepta-2,4-dienamide |
| SMILES | C/C=C\C(\C=C\C(N)=O)=C/CC |
| InChI | InChI=1S/C10H15NO/c1-3-5-9(6-4-2)7-8-10(11)12/h3,5-8H,4H2,1-2H3,(H2,11,12)/b5-3-,8-7+,9-6+ |
| InChIKey | NHVBPODITIRPGT-RJYZPCDXSA-N |
| XLogP | 1.94 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|