C13H16O2 — CID 142006817
2-[(2E,4E)-4-[(Z)-prop-1-enyl]hepta-2,4-dienylidene]propanedial (PubChem CID 142006817) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-[(2E,4E)-4-[(Z)-prop-1-enyl]hepta-2,4-dienylidene]propanedial.
| Compound Name | 2-[(2E,4E)-4-[(Z)-prop-1-enyl]hepta-2,4-dienylidene]propanedial |
|---|---|
| PubChem CID | 142006817 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 2-[(2E,4E)-4-[(Z)-prop-1-enyl]hepta-2,4-dienylidene]propanedial |
| SMILES | C/C=C\C(\C=C\C=C(C=O)C=O)=C/CC |
| InChI | InChI=1S/C13H16O2/c1-3-6-12(7-4-2)8-5-9-13(10-14)11-15/h3,5-11H,4H2,1-2H3/b6-3-,8-5+,12-7+ |
| InChIKey | XXBVJLWRPDBAPA-GFWJICAESA-N |
| XLogP | 2.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|