C18H24 — CID 145128728
(2Z,6E,8E,10E)-4,8-bis[(Z)-prop-1-enyl]dodeca-2,4,6,8,10-pentaene (PubChem CID 145128728) has the molecular formula C18H24 and a molecular weight of 240.39 g/mol. Its IUPAC name is (2Z,6E,8E,10E)-4,8-bis[(Z)-prop-1-enyl]dodeca-2,4,6,8,10-pentaene.
| Compound Name | (2Z,6E,8E,10E)-4,8-bis[(Z)-prop-1-enyl]dodeca-2,4,6,8,10-pentaene |
|---|---|
| PubChem CID | 145128728 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | (2Z,6E,8E,10E)-4,8-bis[(Z)-prop-1-enyl]dodeca-2,4,6,8,10-pentaene |
| SMILES | C/C=C\C(=C/C=C/C(/C=C\C)=C/C=C/C)/C=C\C |
| InChI | InChI=1S/C18H24/c1-5-9-14-18(13-8-4)16-10-15-17(11-6-2)12-7-3/h5-16H,1-4H3/b9-5+,11-6-,12-7-,13-8-,16-10+,18-14+ |
| InChIKey | UWMASTAJFBKBAY-NCYPGBHXSA-N |
| XLogP | 5.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|