C9H14S — CID 126714588
(2Z,4E,6Z)-4-methylsulfanylocta-2,4,6-triene (PubChem CID 126714588) has the molecular formula C9H14S and a molecular weight of 154.28 g/mol. Its IUPAC name is (2Z,4E,6Z)-4-methylsulfanylocta-2,4,6-triene.
| Compound Name | (2Z,4E,6Z)-4-methylsulfanylocta-2,4,6-triene |
|---|---|
| PubChem CID | 126714588 |
| Molecular Formula | C9H14S |
| Molecular Weight | 154.28 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | (2Z,4E,6Z)-4-methylsulfanylocta-2,4,6-triene |
| SMILES | C/C=C\C=C(/C=C\C)SC |
| InChI | InChI=1S/C9H14S/c1-4-6-8-9(10-3)7-5-2/h4-8H,1-3H3/b6-4-,7-5-,9-8+ |
| InChIKey | QVBDVPJVDPUBDJ-VHIIXJFGSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|