C7H9ClS — CID 143926212
[(3E,5Z)-hepta-1,3,5-trien-3-yl] thiohypochlorite (PubChem CID 143926212) has the molecular formula C7H9ClS and a molecular weight of 160.67 g/mol. Its IUPAC name is [(3E,5Z)-hepta-1,3,5-trien-3-yl] thiohypochlorite.
| Compound Name | [(3E,5Z)-hepta-1,3,5-trien-3-yl] thiohypochlorite |
|---|---|
| PubChem CID | 143926212 |
| Molecular Formula | C7H9ClS |
| Molecular Weight | 160.67 g/mol |
| Exact Mass | 160.01 |
| IUPAC Name | [(3E,5Z)-hepta-1,3,5-trien-3-yl] thiohypochlorite |
| SMILES | C=C/C(=C\C=C/C)SCl |
| InChI | InChI=1S/C7H9ClS/c1-3-5-6-7(4-2)9-8/h3-6H,2H2,1H3/b5-3-,7-6+ |
| InChIKey | VSEZBBYIGNHULG-AIJKMKQJSA-N |
| XLogP | 3.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.67 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|