C8H12S — CID 89470385
(3E,5Z)-3-methylsulfanylhepta-1,3,5-triene (PubChem CID 89470385) has the molecular formula C8H12S and a molecular weight of 140.25 g/mol. Its IUPAC name is (3E,5Z)-3-methylsulfanylhepta-1,3,5-triene.
| Compound Name | (3E,5Z)-3-methylsulfanylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 89470385 |
| Molecular Formula | C8H12S |
| Molecular Weight | 140.25 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | (3E,5Z)-3-methylsulfanylhepta-1,3,5-triene |
| SMILES | C=C/C(=C\C=C/C)SC |
| InChI | InChI=1S/C8H12S/c1-4-6-7-8(5-2)9-3/h4-7H,2H2,1,3H3/b6-4-,8-7+ |
| InChIKey | IUVZRTHAUQYWHD-IQTBQJLQSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|