C13H14S2 — CID 142317900
[[(3E,5Z)-hepta-1,3,5-trien-3-yl]disulfanyl]benzene (PubChem CID 142317900) has the molecular formula C13H14S2 and a molecular weight of 234.39 g/mol. Its IUPAC name is [[(3E,5Z)-hepta-1,3,5-trien-3-yl]disulfanyl]benzene.
| Compound Name | [[(3E,5Z)-hepta-1,3,5-trien-3-yl]disulfanyl]benzene |
|---|---|
| PubChem CID | 142317900 |
| Molecular Formula | C13H14S2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | [[(3E,5Z)-hepta-1,3,5-trien-3-yl]disulfanyl]benzene |
| SMILES | C=C/C(=C\C=C/C)SSc1ccccc1 |
| InChI | InChI=1S/C13H14S2/c1-3-5-9-12(4-2)14-15-13-10-7-6-8-11-13/h3-11H,2H2,1H3/b5-3-,12-9+ |
| InChIKey | AZJTXUGDUVJHCY-FNNBZGKSSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|