C20H18S2 — CID 166763410
3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfanyl-2-methylbenzo[f][1]benzothiole (PubChem CID 166763410) has the molecular formula C20H18S2 and a molecular weight of 322.50 g/mol. Its IUPAC name is 3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfanyl-2-methylbenzo[f][1]benzothiole.
| Compound Name | 3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfanyl-2-methylbenzo[f][1]benzothiole |
|---|---|
| PubChem CID | 166763410 |
| Molecular Formula | C20H18S2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfanyl-2-methylbenzo[f][1]benzothiole |
| SMILES | C=C/C(=C\C=C/C)Sc1c(C)sc2cc3ccccc3cc12 |
| InChI | InChI=1S/C20H18S2/c1-4-6-11-17(5-2)22-20-14(3)21-19-13-16-10-8-7-9-15(16)12-18(19)20/h4-13H,2H2,1,3H3/b6-4-,17-11+ |
| InChIKey | SJMWIDZCEFTCAJ-BKKLXTLSSA-N |
| XLogP | 7.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|