C10H18S — CID 142207373
ethane;(3E,5E)-3-methylsulfanylhepta-1,3,5-triene (PubChem CID 142207373) has the molecular formula C10H18S and a molecular weight of 170.32 g/mol. Its IUPAC name is ethane;(3E,5E)-3-methylsulfanylhepta-1,3,5-triene.
| Compound Name | ethane;(3E,5E)-3-methylsulfanylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 142207373 |
| Molecular Formula | C10H18S |
| Molecular Weight | 170.32 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | ethane;(3E,5E)-3-methylsulfanylhepta-1,3,5-triene |
| SMILES | C=C/C(=C\C=C\C)SC.CC |
| InChI | InChI=1S/C8H12S.C2H6/c1-4-6-7-8(5-2)9-3;1-2/h4-7H,2H2,1,3H3;1-2H3/b6-4+,8-7+; |
| InChIKey | YIUOXQQKUDMIEJ-OOTSTRPFSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.32 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|