C12H25N — CID 143793219
ethane;(2E,4Z)-2-ethenylhexa-2,4-dien-1-amine (PubChem CID 143793219) has the molecular formula C12H25N and a molecular weight of 183.34 g/mol. Its IUPAC name is ethane;(2E,4Z)-2-ethenylhexa-2,4-dien-1-amine.
| Compound Name | ethane;(2E,4Z)-2-ethenylhexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 143793219 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | ethane;(2E,4Z)-2-ethenylhexa-2,4-dien-1-amine |
| SMILES | C=C/C(=C\C=C/C)CN.CC.CC |
| InChI | InChI=1S/C8H13N.2C2H6/c1-3-5-6-8(4-2)7-9;2*1-2/h3-6H,2,7,9H2,1H3;2*1-2H3/b5-3-,8-6+;; |
| InChIKey | GDGGYHJVRBKMAY-SENBWYCCSA-N |
| XLogP | 3.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|