C7H11N3 — CID 153376117
(2E)-2-ethenylpenta-2,4-dien-1-amine;molecular nitrogen (PubChem CID 153376117) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is (2E)-2-ethenylpenta-2,4-dien-1-amine;molecular nitrogen.
| Compound Name | (2E)-2-ethenylpenta-2,4-dien-1-amine;molecular nitrogen |
|---|---|
| PubChem CID | 153376117 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | (2E)-2-ethenylpenta-2,4-dien-1-amine;molecular nitrogen |
| SMILES | C=C/C=C(\C=C)CN.N#N |
| InChI | InChI=1S/C7H11N.N2/c1-3-5-7(4-2)6-8;1-2/h3-5H,1-2,6,8H2;/b7-5+; |
| InChIKey | VOJHYNMUXLXVKY-GZOLSCHFSA-N |
| XLogP | 1.27 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|