(2E)-2-ethenylpenta-2,4-dien-1-amine;molecular nitrogen

C7H11N3 — CID 153376117

IUPAC(2E)-2-ethenylpenta-2,4-dien-1-amine;molecular nitrogen
SMILESC=C/C=C(\C=C)CN.N#N
InChIInChI=1S/C7H11N.N2/c1-3-5-7(4-2)6-8;1-2/h3-5H,1-2,6,8H2;/b7-5+;
InChIKeyVOJHYNMUXLXVKY-GZOLSCHFSA-N
MW137.19 g/mol
LogP1.27
Rot. Bonds3

About (2E)-2-ethenylpenta-2,4-dien-1-amine;molecular nitrogen

(2E)-2-ethenylpenta-2,4-dien-1-amine;molecular nitrogen (PubChem CID 153376117) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is (2E)-2-ethenylpenta-2,4-dien-1-amine;molecular nitrogen.

Molecular Properties

Compound Name(2E)-2-ethenylpenta-2,4-dien-1-amine;molecular nitrogen
PubChem CID153376117
Molecular FormulaC7H11N3
Molecular Weight137.19 g/mol
Exact Mass137.10
IUPAC Name(2E)-2-ethenylpenta-2,4-dien-1-amine;molecular nitrogen
SMILESC=C/C=C(\C=C)CN.N#N
InChIInChI=1S/C7H11N.N2/c1-3-5-7(4-2)6-8;1-2/h3-5H,1-2,6,8H2;/b7-5+;
InChIKeyVOJHYNMUXLXVKY-GZOLSCHFSA-N
XLogP1.27
TPSA73.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500137.19
LogP ≤ 51.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (2E)-2-ethenylpenta-2,4-dien-1-amine;molecular nitrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2E)-2-ethenylpenta-2,4-dien-1-amine;molecular nitrogen?
The IUPAC name of (2E)-2-ethenylpenta-2,4-dien-1-amine;molecular nitrogen (CID 153376117) is (2E)-2-ethenylpenta-2,4-dien-1-amine;molecular nitrogen.
What is the SMILES notation for (2E)-2-ethenylpenta-2,4-dien-1-amine;molecular nitrogen?
The canonical SMILES for (2E)-2-ethenylpenta-2,4-dien-1-amine;molecular nitrogen is C=C/C=C(\C=C)CN.N#N.
What is the InChIKey of (2E)-2-ethenylpenta-2,4-dien-1-amine;molecular nitrogen?
The InChIKey is VOJHYNMUXLXVKY-GZOLSCHFSA-N. The full InChI is InChI=1S/C7H11N.N2/c1-3-5-7(4-2)6-8;1-2/h3-5H,1-2,6,8H2;/b7-5+;.
What are the key properties of (2E)-2-ethenylpenta-2,4-dien-1-amine;molecular nitrogen?
(2E)-2-ethenylpenta-2,4-dien-1-amine;molecular nitrogen has a molecular weight of 137.19 g/mol, XLogP of 1.27, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-ethenylpenta-2,4-dien-1-amine;molecular nitrogen is sourced from PubChem (CID 153376117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).