C7H9I — CID 142115416
(3E)-3-(iodomethyl)hexa-1,3,5-triene (PubChem CID 142115416) has the molecular formula C7H9I and a molecular weight of 220.05 g/mol. Its IUPAC name is (3E)-3-(iodomethyl)hexa-1,3,5-triene.
| Compound Name | (3E)-3-(iodomethyl)hexa-1,3,5-triene |
|---|---|
| PubChem CID | 142115416 |
| Molecular Formula | C7H9I |
| Molecular Weight | 220.05 g/mol |
| Exact Mass | 219.97 |
| IUPAC Name | (3E)-3-(iodomethyl)hexa-1,3,5-triene |
| SMILES | C=C/C=C(\C=C)CI |
| InChI | InChI=1S/C7H9I/c1-3-5-7(4-2)6-8/h3-5H,1-2,6H2/b7-5+ |
| InChIKey | OCCMPUKGMSSNGK-FNORWQNLSA-N |
| XLogP | 2.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.05 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|