C10H15I — CID 142018025
(3Z)-4-ethenyl-7-iodoocta-1,3-diene (PubChem CID 142018025) has the molecular formula C10H15I and a molecular weight of 262.13 g/mol. Its IUPAC name is (3Z)-4-ethenyl-7-iodoocta-1,3-diene.
| Compound Name | (3Z)-4-ethenyl-7-iodoocta-1,3-diene |
|---|---|
| PubChem CID | 142018025 |
| Molecular Formula | C10H15I |
| Molecular Weight | 262.13 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | (3Z)-4-ethenyl-7-iodoocta-1,3-diene |
| SMILES | C=C/C=C(\C=C)CCC(C)I |
| InChI | InChI=1S/C10H15I/c1-4-6-10(5-2)8-7-9(3)11/h4-6,9H,1-2,7-8H2,3H3/b10-6+ |
| InChIKey | GSBAKDDZBDQWCN-UXBLZVDNSA-N |
| XLogP | 3.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.13 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|