C9H13F — CID 143712076
(3Z)-4-ethenyl-7-fluorohepta-1,3-diene (PubChem CID 143712076) has the molecular formula C9H13F and a molecular weight of 140.20 g/mol. Its IUPAC name is (3Z)-4-ethenyl-7-fluorohepta-1,3-diene.
| Compound Name | (3Z)-4-ethenyl-7-fluorohepta-1,3-diene |
|---|---|
| PubChem CID | 143712076 |
| Molecular Formula | C9H13F |
| Molecular Weight | 140.20 g/mol |
| Exact Mass | 140.10 |
| IUPAC Name | (3Z)-4-ethenyl-7-fluorohepta-1,3-diene |
| SMILES | C=C/C=C(\C=C)CCCF |
| InChI | InChI=1S/C9H13F/c1-3-6-9(4-2)7-5-8-10/h3-4,6H,1-2,5,7-8H2/b9-6+ |
| InChIKey | MNBQAHMEMKRTAR-RMKNXTFCSA-N |
| XLogP | 3.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.20 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|