C16H31N — CID 143512258
ethane;(3Z)-3-ethenyl-N-methyl-N-prop-1-en-2-ylhexa-3,5-dien-1-amine (PubChem CID 143512258) has the molecular formula C16H31N and a molecular weight of 237.43 g/mol. Its IUPAC name is ethane;(3Z)-3-ethenyl-N-methyl-N-prop-1-en-2-ylhexa-3,5-dien-1-amine.
| Compound Name | ethane;(3Z)-3-ethenyl-N-methyl-N-prop-1-en-2-ylhexa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 143512258 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | ethane;(3Z)-3-ethenyl-N-methyl-N-prop-1-en-2-ylhexa-3,5-dien-1-amine |
| SMILES | C=C/C=C(\C=C)CCN(C)C(=C)C.CC.CC |
| InChI | InChI=1S/C12H19N.2C2H6/c1-6-8-12(7-2)9-10-13(5)11(3)4;2*1-2/h6-8H,1-3,9-10H2,4-5H3;2*1-2H3/b12-8+;; |
| InChIKey | XVDRORZPGBCQLB-BPWZRWDXSA-N |
| XLogP | 5.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|