C11H19N — CID 143803419
(2E)-2-ethenyl-N-methyl-N-propylpenta-2,4-dien-1-amine (PubChem CID 143803419) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is (2E)-2-ethenyl-N-methyl-N-propylpenta-2,4-dien-1-amine.
| Compound Name | (2E)-2-ethenyl-N-methyl-N-propylpenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 143803419 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (2E)-2-ethenyl-N-methyl-N-propylpenta-2,4-dien-1-amine |
| SMILES | C=C/C=C(\C=C)CN(C)CCC |
| InChI | InChI=1S/C11H19N/c1-5-8-11(7-3)10-12(4)9-6-2/h5,7-8H,1,3,6,9-10H2,2,4H3/b11-8+ |
| InChIKey | PSSGCVCLWILKCY-DHZHZOJOSA-N |
| XLogP | 2.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|