C13H26 — CID 142061349
ethane;(3Z)-3-ethylhexa-1,3,5-triene;propane (PubChem CID 142061349) has the molecular formula C13H26 and a molecular weight of 182.35 g/mol. Its IUPAC name is ethane;(3Z)-3-ethylhexa-1,3,5-triene;propane.
| Compound Name | ethane;(3Z)-3-ethylhexa-1,3,5-triene;propane |
|---|---|
| PubChem CID | 142061349 |
| Molecular Formula | C13H26 |
| Molecular Weight | 182.35 g/mol |
| Exact Mass | 182.20 |
| IUPAC Name | ethane;(3Z)-3-ethylhexa-1,3,5-triene;propane |
| SMILES | C=C/C=C(\C=C)CC.CC.CCC |
| InChI | InChI=1S/C8H12.C3H8.C2H6/c1-4-7-8(5-2)6-3;1-3-2;1-2/h4-5,7H,1-2,6H2,3H3;3H2,1-2H3;1-2H3/b8-7+;; |
| InChIKey | XIWQHINIEUUZSU-MIIBGCIDSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.35 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|