C18H28 — CID 171543969
ethane;ethylbenzene;(3Z)-3-ethylhexa-1,3,5-triene (PubChem CID 171543969) has the molecular formula C18H28 and a molecular weight of 244.42 g/mol. Its IUPAC name is ethane;ethylbenzene;(3Z)-3-ethylhexa-1,3,5-triene.
| Compound Name | ethane;ethylbenzene;(3Z)-3-ethylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 171543969 |
| Molecular Formula | C18H28 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | ethane;ethylbenzene;(3Z)-3-ethylhexa-1,3,5-triene |
| SMILES | C=C/C=C(\C=C)CC.CC.CCc1ccccc1 |
| InChI | InChI=1S/C8H10.C8H12.C2H6/c1-2-8-6-4-3-5-7-8;1-4-7-8(5-2)6-3;1-2/h3-7H,2H2,1H3;4-5,7H,1-2,6H2,3H3;1-2H3/b;8-7+; |
| InChIKey | WAVDLCFVLYWVQW-BVUSFOFSSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|