About ethylbenzene;1-phenylprop-2-en-1-one
ethylbenzene;1-phenylprop-2-en-1-one (PubChem CID 174476898) has the molecular formula C17H18O
and a molecular weight of 238.33 g/mol. Its IUPAC name is ethylbenzene;1-phenylprop-2-en-1-one.
Molecular Properties
| Compound Name | ethylbenzene;1-phenylprop-2-en-1-one |
| PubChem CID | 174476898 |
| Molecular Formula | C17H18O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | ethylbenzene;1-phenylprop-2-en-1-one |
| SMILES | C=CC(=O)c1ccccc1.CCc1ccccc1 |
| InChI | InChI=1S/C9H8O.C8H10/c1-2-9(10)8-6-4-3-5-7-8;1-2-8-6-4-3-5-7-8/h2-7H,1H2;3-7H,2H2,1H3 |
| InChIKey | WSCOSUGJHIJHGA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethylbenzene;1-phenylprop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylbenzene;1-phenylprop-2-en-1-one?
The IUPAC name of ethylbenzene;1-phenylprop-2-en-1-one (CID 174476898) is ethylbenzene;1-phenylprop-2-en-1-one.
What is the SMILES notation for ethylbenzene;1-phenylprop-2-en-1-one?
The canonical SMILES for ethylbenzene;1-phenylprop-2-en-1-one is C=CC(=O)c1ccccc1.CCc1ccccc1.
What is the InChIKey of ethylbenzene;1-phenylprop-2-en-1-one?
The InChIKey is WSCOSUGJHIJHGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O.C8H10/c1-2-9(10)8-6-4-3-5-7-8;1-2-8-6-4-3-5-7-8/h2-7H,1H2;3-7H,2H2,1H3.
What are the key properties of ethylbenzene;1-phenylprop-2-en-1-one?
ethylbenzene;1-phenylprop-2-en-1-one has a molecular weight of 238.33 g/mol, XLogP of 4.30, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethylbenzene;1-phenylprop-2-en-1-one is sourced from PubChem (CID 174476898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).