About methanamine;1-phenylprop-2-en-1-one
methanamine;1-phenylprop-2-en-1-one (PubChem CID 91395058) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is methanamine;1-phenylprop-2-en-1-one.
Molecular Properties
| Compound Name | methanamine;1-phenylprop-2-en-1-one |
| PubChem CID | 91395058 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | methanamine;1-phenylprop-2-en-1-one |
| SMILES | C=CC(=O)c1ccccc1.CN.CN |
| InChI | InChI=1S/C9H8O.2CH5N/c1-2-9(10)8-6-4-3-5-7-8;2*1-2/h2-7H,1H2;2*2H2,1H3 |
| InChIKey | NZFHMOHENNGDLI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methanamine;1-phenylprop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;1-phenylprop-2-en-1-one?
The IUPAC name of methanamine;1-phenylprop-2-en-1-one (CID 91395058) is methanamine;1-phenylprop-2-en-1-one.
What is the SMILES notation for methanamine;1-phenylprop-2-en-1-one?
The canonical SMILES for methanamine;1-phenylprop-2-en-1-one is C=CC(=O)c1ccccc1.CN.CN.
What is the InChIKey of methanamine;1-phenylprop-2-en-1-one?
The InChIKey is NZFHMOHENNGDLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O.2CH5N/c1-2-9(10)8-6-4-3-5-7-8;2*1-2/h2-7H,1H2;2*2H2,1H3.
What are the key properties of methanamine;1-phenylprop-2-en-1-one?
methanamine;1-phenylprop-2-en-1-one has a molecular weight of 194.28 g/mol, XLogP of 1.21, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;1-phenylprop-2-en-1-one is sourced from PubChem (CID 91395058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).