About 2-phenylprop-2-enal;(E)-3-phenylprop-2-enal;1-phenylprop-2-en-1-one
2-phenylprop-2-enal;(E)-3-phenylprop-2-enal;1-phenylprop-2-en-1-one (PubChem CID 159261469) has the molecular formula C27H24O3
and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-phenylprop-2-enal;(E)-3-phenylprop-2-enal;1-phenylprop-2-en-1-one.
Molecular Properties
| Compound Name | 2-phenylprop-2-enal;(E)-3-phenylprop-2-enal;1-phenylprop-2-en-1-one |
| PubChem CID | 159261469 |
| Molecular Formula | C27H24O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 2-phenylprop-2-enal;(E)-3-phenylprop-2-enal;1-phenylprop-2-en-1-one |
| SMILES | C=C(C=O)c1ccccc1.C=CC(=O)c1ccccc1.O=C/C=C/c1ccccc1 |
| InChI | InChI=1S/3C9H8O/c1-8(7-10)9-5-3-2-4-6-9;1-2-9(10)8-6-4-3-5-7-8;10-8-4-7-9-5-2-1-3-6-9/h2*2-7H,1H2;1-8H/b;;7-4+ |
| InChIKey | KWOIMQZOGCKXSC-NSBWIVAZSA-N |
| XLogP | 5.85 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylprop-2-enal;(E)-3-phenylprop-2-enal;1-phenylprop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylprop-2-enal;(E)-3-phenylprop-2-enal;1-phenylprop-2-en-1-one?
The IUPAC name of 2-phenylprop-2-enal;(E)-3-phenylprop-2-enal;1-phenylprop-2-en-1-one (CID 159261469) is 2-phenylprop-2-enal;(E)-3-phenylprop-2-enal;1-phenylprop-2-en-1-one.
What is the SMILES notation for 2-phenylprop-2-enal;(E)-3-phenylprop-2-enal;1-phenylprop-2-en-1-one?
The canonical SMILES for 2-phenylprop-2-enal;(E)-3-phenylprop-2-enal;1-phenylprop-2-en-1-one is C=C(C=O)c1ccccc1.C=CC(=O)c1ccccc1.O=C/C=C/c1ccccc1.
What is the InChIKey of 2-phenylprop-2-enal;(E)-3-phenylprop-2-enal;1-phenylprop-2-en-1-one?
The InChIKey is KWOIMQZOGCKXSC-NSBWIVAZSA-N. The full InChI is InChI=1S/3C9H8O/c1-8(7-10)9-5-3-2-4-6-9;1-2-9(10)8-6-4-3-5-7-8;10-8-4-7-9-5-2-1-3-6-9/h2*2-7H,1H2;1-8H/b;;7-4+.
What are the key properties of 2-phenylprop-2-enal;(E)-3-phenylprop-2-enal;1-phenylprop-2-en-1-one?
2-phenylprop-2-enal;(E)-3-phenylprop-2-enal;1-phenylprop-2-en-1-one has a molecular weight of 396.49 g/mol, XLogP of 5.85, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylprop-2-enal;(E)-3-phenylprop-2-enal;1-phenylprop-2-en-1-one is sourced from PubChem (CID 159261469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).