About (2R)-2-hydroxy-2-phenylacetic acid;(E)-3-phenylprop-2-enal
(2R)-2-hydroxy-2-phenylacetic acid;(E)-3-phenylprop-2-enal (PubChem CID 175262474) has the molecular formula C17H16O4
and a molecular weight of 284.31 g/mol. Its IUPAC name is (2R)-2-hydroxy-2-phenylacetic acid;(E)-3-phenylprop-2-enal.
Molecular Properties
| Compound Name | (2R)-2-hydroxy-2-phenylacetic acid;(E)-3-phenylprop-2-enal |
| PubChem CID | 175262474 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | (2R)-2-hydroxy-2-phenylacetic acid;(E)-3-phenylprop-2-enal |
| SMILES | O=C(O)[C@H](O)c1ccccc1.O=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C9H8O.C8H8O3/c10-8-4-7-9-5-2-1-3-6-9;9-7(8(10)11)6-4-2-1-3-5-6/h1-8H;1-5,7,9H,(H,10,11)/b7-4+;/t;7-/m.1/s1 |
| InChIKey | IWOLXIDQBCJCJJ-HVWYIABTSA-N |
| XLogP | 2.70 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-hydroxy-2-phenylacetic acid;(E)-3-phenylprop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-hydroxy-2-phenylacetic acid;(E)-3-phenylprop-2-enal?
The IUPAC name of (2R)-2-hydroxy-2-phenylacetic acid;(E)-3-phenylprop-2-enal (CID 175262474) is (2R)-2-hydroxy-2-phenylacetic acid;(E)-3-phenylprop-2-enal.
What is the SMILES notation for (2R)-2-hydroxy-2-phenylacetic acid;(E)-3-phenylprop-2-enal?
The canonical SMILES for (2R)-2-hydroxy-2-phenylacetic acid;(E)-3-phenylprop-2-enal is O=C(O)[C@H](O)c1ccccc1.O=C/C=C/c1ccccc1.
What is the InChIKey of (2R)-2-hydroxy-2-phenylacetic acid;(E)-3-phenylprop-2-enal?
The InChIKey is IWOLXIDQBCJCJJ-HVWYIABTSA-N. The full InChI is InChI=1S/C9H8O.C8H8O3/c10-8-4-7-9-5-2-1-3-6-9;9-7(8(10)11)6-4-2-1-3-5-6/h1-8H;1-5,7,9H,(H,10,11)/b7-4+;/t;7-/m.1/s1.
What are the key properties of (2R)-2-hydroxy-2-phenylacetic acid;(E)-3-phenylprop-2-enal?
(2R)-2-hydroxy-2-phenylacetic acid;(E)-3-phenylprop-2-enal has a molecular weight of 284.31 g/mol, XLogP of 2.70, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-hydroxy-2-phenylacetic acid;(E)-3-phenylprop-2-enal is sourced from PubChem (CID 175262474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).