About acetaldehyde;buta-1,3-dien-2-ylbenzene
acetaldehyde;buta-1,3-dien-2-ylbenzene (PubChem CID 23325207) has the molecular formula C12H14O
and a molecular weight of 174.24 g/mol. Its IUPAC name is acetaldehyde;buta-1,3-dien-2-ylbenzene.
Molecular Properties
| Compound Name | acetaldehyde;buta-1,3-dien-2-ylbenzene |
| PubChem CID | 23325207 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | acetaldehyde;buta-1,3-dien-2-ylbenzene |
| SMILES | C=CC(=C)c1ccccc1.CC=O |
| InChI | InChI=1S/C10H10.C2H4O/c1-3-9(2)10-7-5-4-6-8-10;1-2-3/h3-8H,1-2H2;2H,1H3 |
| InChIKey | XPNPLVOQRCFSLZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;buta-1,3-dien-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;buta-1,3-dien-2-ylbenzene?
The IUPAC name of acetaldehyde;buta-1,3-dien-2-ylbenzene (CID 23325207) is acetaldehyde;buta-1,3-dien-2-ylbenzene.
What is the SMILES notation for acetaldehyde;buta-1,3-dien-2-ylbenzene?
The canonical SMILES for acetaldehyde;buta-1,3-dien-2-ylbenzene is C=CC(=C)c1ccccc1.CC=O.
What is the InChIKey of acetaldehyde;buta-1,3-dien-2-ylbenzene?
The InChIKey is XPNPLVOQRCFSLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10.C2H4O/c1-3-9(2)10-7-5-4-6-8-10;1-2-3/h3-8H,1-2H2;2H,1H3.
What are the key properties of acetaldehyde;buta-1,3-dien-2-ylbenzene?
acetaldehyde;buta-1,3-dien-2-ylbenzene has a molecular weight of 174.24 g/mol, XLogP of 3.09, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;buta-1,3-dien-2-ylbenzene is sourced from PubChem (CID 23325207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).