About acetaldehyde;benzoic acid
acetaldehyde;benzoic acid (PubChem CID 142179743) has the molecular formula C9H10O3
and a molecular weight of 166.18 g/mol. Its IUPAC name is acetaldehyde;benzoic acid.
Molecular Properties
| Compound Name | acetaldehyde;benzoic acid |
| PubChem CID | 142179743 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | acetaldehyde;benzoic acid |
| SMILES | CC=O.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C7H6O2.C2H4O/c8-7(9)6-4-2-1-3-5-6;1-2-3/h1-5H,(H,8,9);2H,1H3 |
| InChIKey | JOMAVNZTOJCQIH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;benzoic acid?
The IUPAC name of acetaldehyde;benzoic acid (CID 142179743) is acetaldehyde;benzoic acid.
What is the SMILES notation for acetaldehyde;benzoic acid?
The canonical SMILES for acetaldehyde;benzoic acid is CC=O.O=C(O)c1ccccc1.
What is the InChIKey of acetaldehyde;benzoic acid?
The InChIKey is JOMAVNZTOJCQIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C2H4O/c8-7(9)6-4-2-1-3-5-6;1-2-3/h1-5H,(H,8,9);2H,1H3.
What are the key properties of acetaldehyde;benzoic acid?
acetaldehyde;benzoic acid has a molecular weight of 166.18 g/mol, XLogP of 1.59, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;benzoic acid is sourced from PubChem (CID 142179743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).