C11H12O — CID 126638860
(3E)-2-phenylpenta-1,3-dien-3-ol (PubChem CID 126638860) has the molecular formula C11H12O and a molecular weight of 160.22 g/mol. Its IUPAC name is (3E)-2-phenylpenta-1,3-dien-3-ol.
| Compound Name | (3E)-2-phenylpenta-1,3-dien-3-ol |
|---|---|
| PubChem CID | 126638860 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | (3E)-2-phenylpenta-1,3-dien-3-ol |
| SMILES | C=C(/C(O)=C\C)c1ccccc1 |
| InChI | InChI=1S/C11H12O/c1-3-11(12)9(2)10-7-5-4-6-8-10/h3-8,12H,2H2,1H3/b11-3+ |
| InChIKey | UTVKQAYJAHBYHN-QDEBKDIKSA-N |
| XLogP | 3.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|