C11H11I — CID 125477418
[(3Z)-2-iodopenta-1,3-dien-3-yl]benzene (PubChem CID 125477418) has the molecular formula C11H11I and a molecular weight of 270.11 g/mol. Its IUPAC name is [(3Z)-2-iodopenta-1,3-dien-3-yl]benzene.
| Compound Name | [(3Z)-2-iodopenta-1,3-dien-3-yl]benzene |
|---|---|
| PubChem CID | 125477418 |
| Molecular Formula | C11H11I |
| Molecular Weight | 270.11 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | [(3Z)-2-iodopenta-1,3-dien-3-yl]benzene |
| SMILES | C=C(I)/C(=C\C)c1ccccc1 |
| InChI | InChI=1S/C11H11I/c1-3-11(9(2)12)10-7-5-4-6-8-10/h3-8H,2H2,1H3/b11-3+ |
| InChIKey | NTJRDLBUXGCJSK-QDEBKDIKSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.11 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|