C16H20O — CID 143050918
[(2Z,4E)-4-(methoxymethyl)-6-methylhepta-2,4,6-trien-3-yl]benzene (PubChem CID 143050918) has the molecular formula C16H20O and a molecular weight of 228.33 g/mol. Its IUPAC name is [(2Z,4E)-4-(methoxymethyl)-6-methylhepta-2,4,6-trien-3-yl]benzene.
| Compound Name | [(2Z,4E)-4-(methoxymethyl)-6-methylhepta-2,4,6-trien-3-yl]benzene |
|---|---|
| PubChem CID | 143050918 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | [(2Z,4E)-4-(methoxymethyl)-6-methylhepta-2,4,6-trien-3-yl]benzene |
| SMILES | C=C(C)/C=C(COC)\C(=C/C)c1ccccc1 |
| InChI | InChI=1S/C16H20O/c1-5-16(14-9-7-6-8-10-14)15(12-17-4)11-13(2)3/h5-11H,2,12H2,1,3-4H3/b15-11-,16-5- |
| InChIKey | FYEMPRFRAATVHH-IMJPPKPTSA-N |
| XLogP | 4.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|