About dimethoxy(oxo)phosphanium;(E)-3-phenyl-4-phenylmethoxybut-3-en-2-one
dimethoxy(oxo)phosphanium;(E)-3-phenyl-4-phenylmethoxybut-3-en-2-one (PubChem CID 174789890) has the molecular formula C19H22O5P+
and a molecular weight of 361.35 g/mol. Its IUPAC name is dimethoxy(oxo)phosphanium;(E)-3-phenyl-4-phenylmethoxybut-3-en-2-one.
Molecular Properties
| Compound Name | dimethoxy(oxo)phosphanium;(E)-3-phenyl-4-phenylmethoxybut-3-en-2-one |
| PubChem CID | 174789890 |
| Molecular Formula | C19H22O5P+ |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | dimethoxy(oxo)phosphanium;(E)-3-phenyl-4-phenylmethoxybut-3-en-2-one |
| SMILES | CC(=O)/C(=C/OCc1ccccc1)c1ccccc1.CO[P+](=O)OC |
| InChI | InChI=1S/C17H16O2.C2H6O3P/c1-14(18)17(16-10-6-3-7-11-16)13-19-12-15-8-4-2-5-9-15;1-4-6(3)5-2/h2-11,13H,12H2,1H3;1-2H3/q;+1/b17-13-; |
| InChIKey | ZCKBMJATDYGLRH-VSORCOHTSA-N |
| XLogP | 4.77 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethoxy(oxo)phosphanium;(E)-3-phenyl-4-phenylmethoxybut-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxy(oxo)phosphanium;(E)-3-phenyl-4-phenylmethoxybut-3-en-2-one?
The IUPAC name of dimethoxy(oxo)phosphanium;(E)-3-phenyl-4-phenylmethoxybut-3-en-2-one (CID 174789890) is dimethoxy(oxo)phosphanium;(E)-3-phenyl-4-phenylmethoxybut-3-en-2-one.
What is the SMILES notation for dimethoxy(oxo)phosphanium;(E)-3-phenyl-4-phenylmethoxybut-3-en-2-one?
The canonical SMILES for dimethoxy(oxo)phosphanium;(E)-3-phenyl-4-phenylmethoxybut-3-en-2-one is CC(=O)/C(=C/OCc1ccccc1)c1ccccc1.CO[P+](=O)OC.
What is the InChIKey of dimethoxy(oxo)phosphanium;(E)-3-phenyl-4-phenylmethoxybut-3-en-2-one?
The InChIKey is ZCKBMJATDYGLRH-VSORCOHTSA-N. The full InChI is InChI=1S/C17H16O2.C2H6O3P/c1-14(18)17(16-10-6-3-7-11-16)13-19-12-15-8-4-2-5-9-15;1-4-6(3)5-2/h2-11,13H,12H2,1H3;1-2H3/q;+1/b17-13-;.
What are the key properties of dimethoxy(oxo)phosphanium;(E)-3-phenyl-4-phenylmethoxybut-3-en-2-one?
dimethoxy(oxo)phosphanium;(E)-3-phenyl-4-phenylmethoxybut-3-en-2-one has a molecular weight of 361.35 g/mol, XLogP of 4.77, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxy(oxo)phosphanium;(E)-3-phenyl-4-phenylmethoxybut-3-en-2-one is sourced from PubChem (CID 174789890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).