About ethenoxymethylbenzene;ethenyl acetate
ethenoxymethylbenzene;ethenyl acetate (PubChem CID 70503458) has the molecular formula C13H16O3
and a molecular weight of 220.27 g/mol. Its IUPAC name is ethenoxymethylbenzene;ethenyl acetate.
Molecular Properties
| Compound Name | ethenoxymethylbenzene;ethenyl acetate |
| PubChem CID | 70503458 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | ethenoxymethylbenzene;ethenyl acetate |
| SMILES | C=COC(C)=O.C=COCc1ccccc1 |
| InChI | InChI=1S/C9H10O.C4H6O2/c1-2-10-8-9-6-4-3-5-7-9;1-3-6-4(2)5/h2-7H,1,8H2;3H,1H2,2H3 |
| InChIKey | JMHMDDWOMUVHQI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethenoxymethylbenzene;ethenyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenoxymethylbenzene;ethenyl acetate?
The IUPAC name of ethenoxymethylbenzene;ethenyl acetate (CID 70503458) is ethenoxymethylbenzene;ethenyl acetate.
What is the SMILES notation for ethenoxymethylbenzene;ethenyl acetate?
The canonical SMILES for ethenoxymethylbenzene;ethenyl acetate is C=COC(C)=O.C=COCc1ccccc1.
What is the InChIKey of ethenoxymethylbenzene;ethenyl acetate?
The InChIKey is JMHMDDWOMUVHQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O.C4H6O2/c1-2-10-8-9-6-4-3-5-7-9;1-3-6-4(2)5/h2-7H,1,8H2;3H,1H2,2H3.
What are the key properties of ethenoxymethylbenzene;ethenyl acetate?
ethenoxymethylbenzene;ethenyl acetate has a molecular weight of 220.27 g/mol, XLogP of 3.04, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenoxymethylbenzene;ethenyl acetate is sourced from PubChem (CID 70503458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).