C17H22O2 — CID 175320174
buta-1,3-diene;ethenyl acetate;prop-2-enylbenzene (PubChem CID 175320174) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is buta-1,3-diene;ethenyl acetate;prop-2-enylbenzene.
| Compound Name | buta-1,3-diene;ethenyl acetate;prop-2-enylbenzene |
|---|---|
| PubChem CID | 175320174 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | buta-1,3-diene;ethenyl acetate;prop-2-enylbenzene |
| SMILES | C=CC=C.C=CCc1ccccc1.C=COC(C)=O |
| InChI | InChI=1S/C9H10.C4H6O2.C4H6/c1-2-6-9-7-4-3-5-8-9;1-3-6-4(2)5;1-3-4-2/h2-5,7-8H,1,6H2;3H,1H2,2H3;3-4H,1-2H2 |
| InChIKey | QUWWFCOXFJPKMB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|