C9H8F2O — CID 53483110
2,2-difluoroethenoxymethylbenzene (PubChem CID 53483110) has the molecular formula C9H8F2O and a molecular weight of 170.16 g/mol. Its IUPAC name is 2,2-difluoroethenoxymethylbenzene.
| Compound Name | 2,2-difluoroethenoxymethylbenzene |
|---|---|
| PubChem CID | 53483110 |
| Molecular Formula | C9H8F2O |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 2,2-difluoroethenoxymethylbenzene |
| SMILES | FC(F)=COCc1ccccc1 |
| InChI | InChI=1S/C9H8F2O/c10-9(11)7-12-6-8-4-2-1-3-5-8/h1-5,7H,6H2 |
| InChIKey | MTJZTMZOKIIDNV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|