C16H24O2Si — CID 10934722
trimethyl-[(1E,3Z)-2-methyl-1-phenylmethoxypenta-1,3-dien-3-yl]oxysilane (PubChem CID 10934722) has the molecular formula C16H24O2Si and a molecular weight of 276.45 g/mol. Its IUPAC name is trimethyl-[(1E,3Z)-2-methyl-1-phenylmethoxypenta-1,3-dien-3-yl]oxysilane.
| Compound Name | trimethyl-[(1E,3Z)-2-methyl-1-phenylmethoxypenta-1,3-dien-3-yl]oxysilane |
|---|---|
| PubChem CID | 10934722 |
| Molecular Formula | C16H24O2Si |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | trimethyl-[(1E,3Z)-2-methyl-1-phenylmethoxypenta-1,3-dien-3-yl]oxysilane |
| SMILES | C/C=C(O[Si](C)(C)C)/C(C)=C/OCc1ccccc1 |
| InChI | InChI=1S/C16H24O2Si/c1-6-16(18-19(3,4)5)14(2)12-17-13-15-10-8-7-9-11-15/h6-12H,13H2,1-5H3/b14-12+,16-6- |
| InChIKey | LGBUCEXWHYVING-MUJFEPTKSA-N |
| XLogP | 4.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|