C18H28O3Si — CID 11484052
trimethyl-[(1Z,3E)-4-[(2-methylpropan-2-yl)oxy]-1-phenylmethoxybuta-1,3-dien-2-yl]oxysilane (PubChem CID 11484052) has the molecular formula C18H28O3Si and a molecular weight of 320.50 g/mol. Its IUPAC name is trimethyl-[(1Z,3E)-4-[(2-methylpropan-2-yl)oxy]-1-phenylmethoxybuta-1,3-dien-2-yl]oxysilane.
| Compound Name | trimethyl-[(1Z,3E)-4-[(2-methylpropan-2-yl)oxy]-1-phenylmethoxybuta-1,3-dien-2-yl]oxysilane |
|---|---|
| PubChem CID | 11484052 |
| Molecular Formula | C18H28O3Si |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | trimethyl-[(1Z,3E)-4-[(2-methylpropan-2-yl)oxy]-1-phenylmethoxybuta-1,3-dien-2-yl]oxysilane |
| SMILES | CC(C)(C)O/C=C/C(=C/OCc1ccccc1)O[Si](C)(C)C |
| InChI | InChI=1S/C18H28O3Si/c1-18(2,3)20-13-12-17(21-22(4,5)6)15-19-14-16-10-8-7-9-11-16/h7-13,15H,14H2,1-6H3/b13-12+,17-15- |
| InChIKey | TVUPXXNKRVGYOY-WLCJKZAOSA-N |
| XLogP | 5.22 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|