C15H20O — CID 122393351
[(1Z,3E)-5,5-dimethylhexa-1,3-dienoxy]methylbenzene (PubChem CID 122393351) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is [(1Z,3E)-5,5-dimethylhexa-1,3-dienoxy]methylbenzene.
| Compound Name | [(1Z,3E)-5,5-dimethylhexa-1,3-dienoxy]methylbenzene |
|---|---|
| PubChem CID | 122393351 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | [(1Z,3E)-5,5-dimethylhexa-1,3-dienoxy]methylbenzene |
| SMILES | CC(C)(C)/C=C/C=C\OCc1ccccc1 |
| InChI | InChI=1S/C15H20O/c1-15(2,3)11-7-8-12-16-13-14-9-5-4-6-10-14/h4-12H,13H2,1-3H3/b11-7+,12-8- |
| InChIKey | FQKLJQLKECSPKB-RLCSYUECSA-N |
| XLogP | 4.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|