C25H33NO4Si — CID 102297158
(4R)-4-benzyl-3-[(Z)-1-[tert-butyl(dimethyl)silyl]oxy-2-phenylmethoxyethenyl]-1,3-oxazolidin-2-one (PubChem CID 102297158) has the molecular formula C25H33NO4Si and a molecular weight of 439.63 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(Z)-1-[tert-butyl(dimethyl)silyl]oxy-2-phenylmethoxyethenyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(Z)-1-[tert-butyl(dimethyl)silyl]oxy-2-phenylmethoxyethenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102297158 |
| Molecular Formula | C25H33NO4Si |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | (4R)-4-benzyl-3-[(Z)-1-[tert-butyl(dimethyl)silyl]oxy-2-phenylmethoxyethenyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O/C(=C\OCc1ccccc1)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C25H33NO4Si/c1-25(2,3)31(4,5)30-23(19-28-17-21-14-10-7-11-15-21)26-22(18-29-24(26)27)16-20-12-8-6-9-13-20/h6-15,19,22H,16-18H2,1-5H3/b23-19-/t22-/m1/s1 |
| InChIKey | MBBUZNUYYIPDJV-SXKPWUIASA-N |
| XLogP | 6.09 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|