C21H31NO4Si — CID 101241804
(4S)-4-benzyl-3-[(E)-5-[tert-butyl(dimethyl)silyl]oxypent-2-enoyl]-1,3-oxazolidin-2-one (PubChem CID 101241804) has the molecular formula C21H31NO4Si and a molecular weight of 389.57 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(E)-5-[tert-butyl(dimethyl)silyl]oxypent-2-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(E)-5-[tert-butyl(dimethyl)silyl]oxypent-2-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101241804 |
| Molecular Formula | C21H31NO4Si |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | (4S)-4-benzyl-3-[(E)-5-[tert-butyl(dimethyl)silyl]oxypent-2-enoyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC/C=C/C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C21H31NO4Si/c1-21(2,3)27(4,5)26-14-10-9-13-19(23)22-18(16-25-20(22)24)15-17-11-7-6-8-12-17/h6-9,11-13,18H,10,14-16H2,1-5H3/b13-9+/t18-/m0/s1 |
| InChIKey | BBPBRABUVGYZKY-FUNAXGEOSA-N |
| XLogP | 4.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|