C38H41NO5Si — CID 10908274
(4S)-4-benzyl-3-[(E,4S)-5-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxypent-2-enoyl]-1,3-oxazolidin-2-one (PubChem CID 10908274) has the molecular formula C38H41NO5Si and a molecular weight of 619.83 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(E,4S)-5-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxypent-2-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(E,4S)-5-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxypent-2-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10908274 |
| Molecular Formula | C38H41NO5Si |
| Molecular Weight | 619.83 g/mol |
| Exact Mass | 619.28 |
| IUPAC Name | (4S)-4-benzyl-3-[(E,4S)-5-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxypent-2-enoyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C)[Si](OC[C@H](/C=C/C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H41NO5Si/c1-38(2,3)45(34-20-12-6-13-21-34,35-22-14-7-15-23-35)44-29-33(42-27-31-18-10-5-11-19-31)24-25-36(40)39-32(28-43-37(39)41)26-30-16-8-4-9-17-30/h4-25,32-33H,26-29H2,1-3H3/b25-24+/t32-,33-/m0/s1 |
| InChIKey | OREGONGLVGLEFO-FCLIKSDBSA-N |
| XLogP | 6.29 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.83 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|