C34H41NO5Si — CID 11592251
(4S)-4-benzyl-3-[(Z,2S,3R)-6-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2,5-dimethylhex-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 11592251) has the molecular formula C34H41NO5Si and a molecular weight of 571.79 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(Z,2S,3R)-6-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2,5-dimethylhex-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(Z,2S,3R)-6-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2,5-dimethylhex-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11592251 |
| Molecular Formula | C34H41NO5Si |
| Molecular Weight | 571.79 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | (4S)-4-benzyl-3-[(Z,2S,3R)-6-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2,5-dimethylhex-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C/C(=C/[C@@H](O)[C@H](C)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H41NO5Si/c1-25(23-40-41(34(3,4)5,29-17-11-7-12-18-29)30-19-13-8-14-20-30)21-31(36)26(2)32(37)35-28(24-39-33(35)38)22-27-15-9-6-10-16-27/h6-21,26,28,31,36H,22-24H2,1-5H3/b25-21-/t26-,28-,31+/m0/s1 |
| InChIKey | WDTRGPHUTPSEEI-DYUSVQAGSA-N |
| XLogP | 5.10 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.79 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|