C23H33NO4Si — CID 101222413
(4R)-4-benzyl-3-[(2R,3R)-5-[tert-butyl(dimethyl)silyl]-3-methoxy-2-methylpent-4-ynoyl]-1,3-oxazolidin-2-one (PubChem CID 101222413) has the molecular formula C23H33NO4Si and a molecular weight of 415.61 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2R,3R)-5-[tert-butyl(dimethyl)silyl]-3-methoxy-2-methylpent-4-ynoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2R,3R)-5-[tert-butyl(dimethyl)silyl]-3-methoxy-2-methylpent-4-ynoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101222413 |
| Molecular Formula | C23H33NO4Si |
| Molecular Weight | 415.61 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | (4R)-4-benzyl-3-[(2R,3R)-5-[tert-butyl(dimethyl)silyl]-3-methoxy-2-methylpent-4-ynoyl]-1,3-oxazolidin-2-one |
| SMILES | CO[C@@H](C#C[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C23H33NO4Si/c1-17(20(27-5)13-14-29(6,7)23(2,3)4)21(25)24-19(16-28-22(24)26)15-18-11-9-8-10-12-18/h8-12,17,19-20H,15-16H2,1-7H3/t17-,19-,20+/m1/s1 |
| InChIKey | BMVOQSLHPFLHQM-RLLQIKCJSA-N |
| XLogP | 4.28 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.61 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|