C20H29NO4Si — CID 53470469
(4R)-4-benzyl-3-[(2S,3R)-2,4-dimethyl-3-trimethylsilyloxypent-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 53470469) has the molecular formula C20H29NO4Si and a molecular weight of 375.54 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2S,3R)-2,4-dimethyl-3-trimethylsilyloxypent-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2S,3R)-2,4-dimethyl-3-trimethylsilyloxypent-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 53470469 |
| Molecular Formula | C20H29NO4Si |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | (4R)-4-benzyl-3-[(2S,3R)-2,4-dimethyl-3-trimethylsilyloxypent-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C=C(C)[C@H](O[Si](C)(C)C)[C@H](C)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C20H29NO4Si/c1-14(2)18(25-26(4,5)6)15(3)19(22)21-17(13-24-20(21)23)12-16-10-8-7-9-11-16/h7-11,15,17-18H,1,12-13H2,2-6H3/t15-,17+,18-/m0/s1 |
| InChIKey | NZEIBNRSMYDYKH-JQHSSLGASA-N |
| XLogP | 4.01 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|