C23H35NO5Si — CID 101354502
(2R,3R,4S)-5-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-5-oxopentanal (PubChem CID 101354502) has the molecular formula C23H35NO5Si and a molecular weight of 433.62 g/mol. Its IUPAC name is (2R,3R,4S)-5-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-5-oxopentanal.
| Compound Name | (2R,3R,4S)-5-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-5-oxopentanal |
|---|---|
| PubChem CID | 101354502 |
| Molecular Formula | C23H35NO5Si |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | (2R,3R,4S)-5-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-5-oxopentanal |
| SMILES | CC(C=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C23H35NO5Si/c1-16(14-25)20(29-30(6,7)23(3,4)5)17(2)21(26)24-19(15-28-22(24)27)13-18-11-9-8-10-12-18/h8-12,14,16-17,19-20H,13,15H2,1-7H3/t16?,17-,19-,20+/m0/s1 |
| InChIKey | MMVIXNYMYDKPOD-WOCFUTGOSA-N |
| XLogP | 4.44 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|