C27H41NO4Si — CID 11102769
(4S)-4-benzyl-3-[(E,2S,3R)-3-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-2-[(Z)-prop-1-enyl]hex-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 11102769) has the molecular formula C27H41NO4Si and a molecular weight of 471.71 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(E,2S,3R)-3-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-2-[(Z)-prop-1-enyl]hex-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(E,2S,3R)-3-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-2-[(Z)-prop-1-enyl]hex-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11102769 |
| Molecular Formula | C27H41NO4Si |
| Molecular Weight | 471.71 g/mol |
| Exact Mass | 471.28 |
| IUPAC Name | (4S)-4-benzyl-3-[(E,2S,3R)-3-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-2-[(Z)-prop-1-enyl]hex-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C/C=C\[C@H](C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)[C@@H](/C=C/C)O[Si](C)(C)C(C)(C)C(C)C |
| InChI | InChI=1S/C27H41NO4Si/c1-9-14-23(24(15-10-2)32-33(7,8)27(5,6)20(3)4)25(29)28-22(19-31-26(28)30)18-21-16-12-11-13-17-21/h9-17,20,22-24H,18-19H2,1-8H3/b14-9-,15-10+/t22-,23-,24+/m0/s1 |
| InChIKey | VLXMANJAVCHJAN-HNQZBCJWSA-N |
| XLogP | 6.37 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.71 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|