C40H57NO5Si2 — CID 12000541
(4R)-4-benzyl-3-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-7-[tert-butyl(diphenyl)silyl]oxy-2-methylheptanoyl]-1,3-oxazolidin-2-one (PubChem CID 12000541) has the molecular formula C40H57NO5Si2 and a molecular weight of 688.07 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-7-[tert-butyl(diphenyl)silyl]oxy-2-methylheptanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-7-[tert-butyl(diphenyl)silyl]oxy-2-methylheptanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 12000541 |
| Molecular Formula | C40H57NO5Si2 |
| Molecular Weight | 688.07 g/mol |
| Exact Mass | 687.38 |
| IUPAC Name | (4R)-4-benzyl-3-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-7-[tert-butyl(diphenyl)silyl]oxy-2-methylheptanoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@@H](C(=O)N1C(=O)OC[C@H]1Cc1ccccc1)[C@H](CCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C40H57NO5Si2/c1-31(37(42)41-33(30-44-38(41)43)29-32-21-13-10-14-22-32)36(46-47(8,9)39(2,3)4)27-19-20-28-45-48(40(5,6)7,34-23-15-11-16-24-34)35-25-17-12-18-26-35/h10-18,21-26,31,33,36H,19-20,27-30H2,1-9H3/t31-,33-,36+/m1/s1 |
| InChIKey | YLJHUNAKIIHDBR-VZDRTSEESA-N |
| XLogP | 8.35 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.07 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|