C33H39NO4Si — CID 12018409
(4R)-4-benzyl-3-[(E,5R)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhex-2-enoyl]-1,3-oxazolidin-2-one (PubChem CID 12018409) has the molecular formula C33H39NO4Si and a molecular weight of 541.76 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(E,5R)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhex-2-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(E,5R)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhex-2-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 12018409 |
| Molecular Formula | C33H39NO4Si |
| Molecular Weight | 541.76 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | (4R)-4-benzyl-3-[(E,5R)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhex-2-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@H](C/C=C/C(=O)N1C(=O)OC[C@H]1Cc1ccccc1)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H39NO4Si/c1-26(15-14-22-31(35)34-28(25-37-32(34)36)23-27-16-8-5-9-17-27)24-38-39(33(2,3)4,29-18-10-6-11-19-29)30-20-12-7-13-21-30/h5-14,16-22,26,28H,15,23-25H2,1-4H3/b22-14+/t26-,28-/m1/s1 |
| InChIKey | BKAPHTCNYQDRJJ-NTHYDAKXSA-N |
| XLogP | 5.74 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.76 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|