C33H39NO5Si — CID 11330400
(4R)-4-benzyl-3-[(E,2R,3S)-6-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2-methylhex-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 11330400) has the molecular formula C33H39NO5Si and a molecular weight of 557.76 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(E,2R,3S)-6-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2-methylhex-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(E,2R,3S)-6-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2-methylhex-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11330400 |
| Molecular Formula | C33H39NO5Si |
| Molecular Weight | 557.76 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | (4R)-4-benzyl-3-[(E,2R,3S)-6-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2-methylhex-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@@H](C(=O)N1C(=O)OC[C@H]1Cc1ccccc1)[C@@H](O)/C=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H39NO5Si/c1-25(31(36)34-27(24-38-32(34)37)23-26-15-8-5-9-16-26)30(35)21-14-22-39-40(33(2,3)4,28-17-10-6-11-18-28)29-19-12-7-13-20-29/h5-21,25,27,30,35H,22-24H2,1-4H3/b21-14+/t25-,27-,30+/m1/s1 |
| InChIKey | OEZBPCMPMCWIPA-UWXVNBBBSA-N |
| XLogP | 4.71 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.76 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|