C36H47NO6Si — CID 102325351
(4R)-4-benzyl-3-[(2R,3R,4S,5S,6R)-7-[tert-butyl(diphenyl)silyl]oxy-3,5-dihydroxy-2,4,6-trimethylheptanoyl]-1,3-oxazolidin-2-one (PubChem CID 102325351) has the molecular formula C36H47NO6Si and a molecular weight of 617.86 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2R,3R,4S,5S,6R)-7-[tert-butyl(diphenyl)silyl]oxy-3,5-dihydroxy-2,4,6-trimethylheptanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2R,3R,4S,5S,6R)-7-[tert-butyl(diphenyl)silyl]oxy-3,5-dihydroxy-2,4,6-trimethylheptanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102325351 |
| Molecular Formula | C36H47NO6Si |
| Molecular Weight | 617.86 g/mol |
| Exact Mass | 617.32 |
| IUPAC Name | (4R)-4-benzyl-3-[(2R,3R,4S,5S,6R)-7-[tert-butyl(diphenyl)silyl]oxy-3,5-dihydroxy-2,4,6-trimethylheptanoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@@H]([C@@H](O)[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](O)[C@@H](C)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C36H47NO6Si/c1-25(23-43-44(36(4,5)6,30-18-12-8-13-19-30)31-20-14-9-15-21-31)32(38)26(2)33(39)27(3)34(40)37-29(24-42-35(37)41)22-28-16-10-7-11-17-28/h7-21,25-27,29,32-33,38-39H,22-24H2,1-6H3/t25-,26+,27-,29-,32+,33-/m1/s1 |
| InChIKey | RVDZGHOZMFOFFM-GXEYQOLSSA-N |
| XLogP | 4.78 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.86 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|