C20H23NO5 — CID 57382156
[(1Z,3S,5E)-7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3-methyl-7-oxohepta-1,5-dienyl] acetate (PubChem CID 57382156) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is [(1Z,3S,5E)-7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3-methyl-7-oxohepta-1,5-dienyl] acetate.
| Compound Name | [(1Z,3S,5E)-7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3-methyl-7-oxohepta-1,5-dienyl] acetate |
|---|---|
| PubChem CID | 57382156 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | [(1Z,3S,5E)-7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3-methyl-7-oxohepta-1,5-dienyl] acetate |
| SMILES | CC(=O)O/C=C\[C@@H](C)C/C=C/C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C20H23NO5/c1-15(11-12-25-16(2)22)7-6-10-19(23)21-18(14-26-20(21)24)13-17-8-4-3-5-9-17/h3-6,8-12,15,18H,7,13-14H2,1-2H3/b10-6+,12-11-/t15-,18-/m0/s1 |
| InChIKey | HWDMXZHBRBJPHK-HQUUFJDDSA-N |
| XLogP | 3.24 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|